C16H17ClN2O3S — CID 166781696
N-(3-chloro-2-methoxyphenyl)-4-hydroxy-2-oxo-1,4a,5,6,7,7a-hexahydrocyclopenta[b]pyridine-3-carbothioamide (PubChem CID 166781696) has the molecular formula C16H17ClN2O3S and a molecular weight of 352.84 g/mol. Its IUPAC name is N-(3-chloro-2-methoxyphenyl)-4-hydroxy-2-oxo-1,4a,5,6,7,7a-hexahydrocyclopenta[b]pyridine-3-carbothioamide.
| Compound Name | N-(3-chloro-2-methoxyphenyl)-4-hydroxy-2-oxo-1,4a,5,6,7,7a-hexahydrocyclopenta[b]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 166781696 |
| Molecular Formula | C16H17ClN2O3S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | N-(3-chloro-2-methoxyphenyl)-4-hydroxy-2-oxo-1,4a,5,6,7,7a-hexahydrocyclopenta[b]pyridine-3-carbothioamide |
| SMILES | COc1c(Cl)cccc1NC(=S)C1=C(O)C2CCCC2NC1=O |
| InChI | InChI=1S/C16H17ClN2O3S/c1-22-14-9(17)5-3-7-11(14)19-16(23)12-13(20)8-4-2-6-10(8)18-15(12)21/h3,5,7-8,10,20H,2,4,6H2,1H3,(H,18,21)(H,19,23) |
| InChIKey | GTEOTIUODGFICW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|