C14H13ClN2O4S — CID 175716779
5-[(3-chloro-2-methoxyphenyl)carbamothioyl]-6-oxo-2,3-dihydropyridine-1-carboxylic acid (PubChem CID 175716779) has the molecular formula C14H13ClN2O4S and a molecular weight of 340.79 g/mol. Its IUPAC name is 5-[(3-chloro-2-methoxyphenyl)carbamothioyl]-6-oxo-2,3-dihydropyridine-1-carboxylic acid.
| Compound Name | 5-[(3-chloro-2-methoxyphenyl)carbamothioyl]-6-oxo-2,3-dihydropyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 175716779 |
| Molecular Formula | C14H13ClN2O4S |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 5-[(3-chloro-2-methoxyphenyl)carbamothioyl]-6-oxo-2,3-dihydropyridine-1-carboxylic acid |
| SMILES | COc1c(Cl)cccc1NC(=S)C1=CCCN(C(=O)O)C1=O |
| InChI | InChI=1S/C14H13ClN2O4S/c1-21-11-9(15)5-2-6-10(11)16-12(22)8-4-3-7-17(13(8)18)14(19)20/h2,4-6H,3,7H2,1H3,(H,16,22)(H,19,20) |
| InChIKey | GSJIWZVGIUMGAN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|