C27H31ClN4O4S — CID 156870260
(4aS,7aR)-N-(3-chloro-2-methoxyphenyl)-2-oxo-4-[[3-[[(2S)-oxolan-2-yl]methoxy]-4-pyridinyl]methylamino]-1,4a,5,6,7,7a-hexahydrocyclopenta[b]pyridine-3-carbothioamide (PubChem CID 156870260) has the molecular formula C27H31ClN4O4S and a molecular weight of 543.09 g/mol. Its IUPAC name is (4aS,7aR)-N-(3-chloro-2-methoxyphenyl)-2-oxo-4-[[3-[[(2S)-oxolan-2-yl]methoxy]-4-pyridinyl]methylamino]-1,4a,5,6,7,7a-hexahydrocyclopenta[b]pyridine-3-carbothioamide.
| Compound Name | (4aS,7aR)-N-(3-chloro-2-methoxyphenyl)-2-oxo-4-[[3-[[(2S)-oxolan-2-yl]methoxy]-4-pyridinyl]methylamino]-1,4a,5,6,7,7a-hexahydrocyclopenta[b]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 156870260 |
| Molecular Formula | C27H31ClN4O4S |
| Molecular Weight | 543.09 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | (4aS,7aR)-N-(3-chloro-2-methoxyphenyl)-2-oxo-4-[[3-[[(2S)-oxolan-2-yl]methoxy]-4-pyridinyl]methylamino]-1,4a,5,6,7,7a-hexahydrocyclopenta[b]pyridine-3-carbothioamide |
| SMILES | COc1c(Cl)cccc1NC(=S)C1=C(NCc2ccncc2OC[C@@H]2CCCO2)[C@H]2CCC[C@H]2NC1=O |
| InChI | InChI=1S/C27H31ClN4O4S/c1-34-25-19(28)7-3-9-21(25)32-27(37)23-24(18-6-2-8-20(18)31-26(23)33)30-13-16-10-11-29-14-22(16)36-15-17-5-4-12-35-17/h3,7,9-11,14,17-18,20,30H,2,4-6,8,12-13,15H2,1H3,(H,31,33)(H,32,37)/t17-,18-,20+/m0/s1 |
| InChIKey | HPUKXHAAZBOXDK-CMKODMSKSA-N |
| XLogP | 4.38 |
| TPSA | 93.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.09 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|