C12H11FN2O2 — CID 105424112
8-fluoro-9-methoxy-2,3,4,5-tetrahydropyrido[4,3-b]indol-1-one (PubChem CID 105424112) has the molecular formula C12H11FN2O2 and a molecular weight of 234.23 g/mol. Its IUPAC name is 8-fluoro-9-methoxy-2,3,4,5-tetrahydropyrido[4,3-b]indol-1-one.
| Compound Name | 8-fluoro-9-methoxy-2,3,4,5-tetrahydropyrido[4,3-b]indol-1-one |
|---|---|
| PubChem CID | 105424112 |
| Molecular Formula | C12H11FN2O2 |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 8-fluoro-9-methoxy-2,3,4,5-tetrahydropyrido[4,3-b]indol-1-one |
| SMILES | COc1c(F)ccc2[nH]c3c(c12)C(=O)NCC3 |
| InChI | InChI=1S/C12H11FN2O2/c1-17-11-6(13)2-3-7-9(11)10-8(15-7)4-5-14-12(10)16/h2-3,15H,4-5H2,1H3,(H,14,16) |
| InChIKey | VUVUKFUBNJPKPD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |