C11H8ClFN2O — CID 105424119
8-chloro-7-fluoro-2,3,4,5-tetrahydropyrido[4,3-b]indol-1-one (PubChem CID 105424119) has the molecular formula C11H8ClFN2O and a molecular weight of 238.65 g/mol. Its IUPAC name is 8-chloro-7-fluoro-2,3,4,5-tetrahydropyrido[4,3-b]indol-1-one.
| Compound Name | 8-chloro-7-fluoro-2,3,4,5-tetrahydropyrido[4,3-b]indol-1-one |
|---|---|
| PubChem CID | 105424119 |
| Molecular Formula | C11H8ClFN2O |
| Molecular Weight | 238.65 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 8-chloro-7-fluoro-2,3,4,5-tetrahydropyrido[4,3-b]indol-1-one |
| SMILES | O=C1NCCc2[nH]c3cc(F)c(Cl)cc3c21 |
| InChI | InChI=1S/C11H8ClFN2O/c12-6-3-5-9(4-7(6)13)15-8-1-2-14-11(16)10(5)8/h3-4,15H,1-2H2,(H,14,16) |
| InChIKey | ZJKAEHLHUINEGN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.65 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |