C12H12N2O2 — CID 105424090
6-hydroxy-8-methyl-2,3,4,5-tetrahydropyrido[4,3-b]indol-1-one (PubChem CID 105424090) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 6-hydroxy-8-methyl-2,3,4,5-tetrahydropyrido[4,3-b]indol-1-one.
| Compound Name | 6-hydroxy-8-methyl-2,3,4,5-tetrahydropyrido[4,3-b]indol-1-one |
|---|---|
| PubChem CID | 105424090 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 6-hydroxy-8-methyl-2,3,4,5-tetrahydropyrido[4,3-b]indol-1-one |
| SMILES | Cc1cc(O)c2[nH]c3c(c2c1)C(=O)NCC3 |
| InChI | InChI=1S/C12H12N2O2/c1-6-4-7-10-8(2-3-13-12(10)16)14-11(7)9(15)5-6/h4-5,14-15H,2-3H2,1H3,(H,13,16) |
| InChIKey | ZFOIQERJUFZVFX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |