C11H11N3O — CID 105424073
8-amino-2,3,4,5-tetrahydropyrido[4,3-b]indol-1-one (PubChem CID 105424073) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 8-amino-2,3,4,5-tetrahydropyrido[4,3-b]indol-1-one.
| Compound Name | 8-amino-2,3,4,5-tetrahydropyrido[4,3-b]indol-1-one |
|---|---|
| PubChem CID | 105424073 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 8-amino-2,3,4,5-tetrahydropyrido[4,3-b]indol-1-one |
| SMILES | Nc1ccc2[nH]c3c(c2c1)C(=O)NCC3 |
| InChI | InChI=1S/C11H11N3O/c12-6-1-2-8-7(5-6)10-9(14-8)3-4-13-11(10)15/h1-2,5,14H,3-4,12H2,(H,13,15) |
| InChIKey | BNLLDYUXBFKLGA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|