C12H12N2O — CID 105424071
7-methyl-2,3,4,5-tetrahydropyrido[4,3-b]indol-1-one (PubChem CID 105424071) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 7-methyl-2,3,4,5-tetrahydropyrido[4,3-b]indol-1-one.
| Compound Name | 7-methyl-2,3,4,5-tetrahydropyrido[4,3-b]indol-1-one |
|---|---|
| PubChem CID | 105424071 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 7-methyl-2,3,4,5-tetrahydropyrido[4,3-b]indol-1-one |
| SMILES | Cc1ccc2c3c([nH]c2c1)CCNC3=O |
| InChI | InChI=1S/C12H12N2O/c1-7-2-3-8-10(6-7)14-9-4-5-13-12(15)11(8)9/h2-3,6,14H,4-5H2,1H3,(H,13,15) |
| InChIKey | AJRRMWZQXHIHIE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |