C14H14N2O2 — CID 170858085
7,10-dimethyl-3,4-dihydro-2H-azepino[3,4-b]indole-1,5-dione (PubChem CID 170858085) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 7,10-dimethyl-3,4-dihydro-2H-azepino[3,4-b]indole-1,5-dione.
| Compound Name | 7,10-dimethyl-3,4-dihydro-2H-azepino[3,4-b]indole-1,5-dione |
|---|---|
| PubChem CID | 170858085 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 7,10-dimethyl-3,4-dihydro-2H-azepino[3,4-b]indole-1,5-dione |
| SMILES | Cc1ccc2c(c1)c1c(n2C)C(=O)NCCC1=O |
| InChI | InChI=1S/C14H14N2O2/c1-8-3-4-10-9(7-8)12-11(17)5-6-15-14(18)13(12)16(10)2/h3-4,7H,5-6H2,1-2H3,(H,15,18) |
| InChIKey | JQQNKZQILBHSAR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |