C25H24FN5O4 — CID 171398721
3-(3-fluoro-2-methoxyanilino)-2-[6-(2-methoxyethoxy)-1,5-naphthyridin-4-yl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 171398721) has the molecular formula C25H24FN5O4 and a molecular weight of 477.50 g/mol. Its IUPAC name is 3-(3-fluoro-2-methoxyanilino)-2-[6-(2-methoxyethoxy)-1,5-naphthyridin-4-yl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 3-(3-fluoro-2-methoxyanilino)-2-[6-(2-methoxyethoxy)-1,5-naphthyridin-4-yl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 171398721 |
| Molecular Formula | C25H24FN5O4 |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 3-(3-fluoro-2-methoxyanilino)-2-[6-(2-methoxyethoxy)-1,5-naphthyridin-4-yl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | COCCOc1ccc2nccc(-c3[nH]c4c(c3Nc3cccc(F)c3OC)C(=O)NCC4)c2n1 |
| InChI | InChI=1S/C25H24FN5O4/c1-33-12-13-35-19-7-6-17-21(31-19)14(8-10-27-17)22-23(20-16(29-22)9-11-28-25(20)32)30-18-5-3-4-15(26)24(18)34-2/h3-8,10,29-30H,9,11-13H2,1-2H3,(H,28,32) |
| InChIKey | UPTCKUJMAHGUEY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 110.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|