C25H29FN4O4 — CID 163292316
3-(3-fluoro-2-methoxyanilino)-2-[3-[(E)-pent-3-enoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one;methanol (PubChem CID 163292316) has the molecular formula C25H29FN4O4 and a molecular weight of 468.53 g/mol. Its IUPAC name is 3-(3-fluoro-2-methoxyanilino)-2-[3-[(E)-pent-3-enoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one;methanol.
| Compound Name | 3-(3-fluoro-2-methoxyanilino)-2-[3-[(E)-pent-3-enoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one;methanol |
|---|---|
| PubChem CID | 163292316 |
| Molecular Formula | C25H29FN4O4 |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 3-(3-fluoro-2-methoxyanilino)-2-[3-[(E)-pent-3-enoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one;methanol |
| SMILES | C/C=C/CCOc1cnccc1-c1[nH]c2c(c1Nc1cccc(F)c1OC)C(=O)NCC2.CO |
| InChI | InChI=1S/C24H25FN4O3.CH4O/c1-3-4-5-13-32-19-14-26-11-9-15(19)21-22(20-17(28-21)10-12-27-24(20)30)29-18-8-6-7-16(25)23(18)31-2;1-2/h3-4,6-9,11,14,28-29H,5,10,12-13H2,1-2H3,(H,27,30);2H,1H3/b4-3+; |
| InChIKey | RVQGZPBRPQXCCQ-BJILWQEISA-N |
| XLogP | 4.21 |
| TPSA | 108.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|