C26H30FN5O3 — CID 169253066
3-(3-fluoro-2-methoxyanilino)-2-[3-[[(Z)-6-hydroxy-4-methylhex-3-enyl]amino]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 169253066) has the molecular formula C26H30FN5O3 and a molecular weight of 479.56 g/mol. Its IUPAC name is 3-(3-fluoro-2-methoxyanilino)-2-[3-[[(Z)-6-hydroxy-4-methylhex-3-enyl]amino]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 3-(3-fluoro-2-methoxyanilino)-2-[3-[[(Z)-6-hydroxy-4-methylhex-3-enyl]amino]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 169253066 |
| Molecular Formula | C26H30FN5O3 |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 3-(3-fluoro-2-methoxyanilino)-2-[3-[[(Z)-6-hydroxy-4-methylhex-3-enyl]amino]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | COc1c(F)cccc1Nc1c(-c2ccncc2NCC/C=C(/C)CCO)[nH]c2c1C(=O)NCC2 |
| InChI | InChI=1S/C26H30FN5O3/c1-16(10-14-33)5-4-11-29-21-15-28-12-8-17(21)23-24(22-19(31-23)9-13-30-26(22)34)32-20-7-3-6-18(27)25(20)35-2/h3,5-8,12,15,29,31-33H,4,9-11,13-14H2,1-2H3,(H,30,34)/b16-5- |
| InChIKey | NTIPLIZHDLUWMC-BNCCVWRVSA-N |
| XLogP | 4.38 |
| TPSA | 111.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|