C28H30N4O6S — CID 14256696
diethyl (2S)-2-[[4-[(4-oxo-2-sulfanylidene-1H-quinazolin-6-yl)methyl-prop-2-ynylamino]benzoyl]amino]pentanedioate (PubChem CID 14256696) has the molecular formula C28H30N4O6S and a molecular weight of 550.64 g/mol. Its IUPAC name is diethyl (2S)-2-[[4-[(4-oxo-2-sulfanylidene-1H-quinazolin-6-yl)methyl-prop-2-ynylamino]benzoyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[4-[(4-oxo-2-sulfanylidene-1H-quinazolin-6-yl)methyl-prop-2-ynylamino]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 14256696 |
| Molecular Formula | C28H30N4O6S |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | diethyl (2S)-2-[[4-[(4-oxo-2-sulfanylidene-1H-quinazolin-6-yl)methyl-prop-2-ynylamino]benzoyl]amino]pentanedioate |
| SMILES | C#CCN(Cc1ccc2[nH]c(=S)[nH]c(=O)c2c1)c1ccc(C(=O)N[C@@H](CCC(=O)OCC)C(=O)OCC)cc1 |
| InChI | InChI=1S/C28H30N4O6S/c1-4-15-32(17-18-7-12-22-21(16-18)26(35)31-28(39)30-22)20-10-8-19(9-11-20)25(34)29-23(27(36)38-6-3)13-14-24(33)37-5-2/h1,7-12,16,23H,5-6,13-15,17H2,2-3H3,(H,29,34)(H2,30,31,35,39)/t23-/m0/s1 |
| InChIKey | OWTXLTSXICPENA-QHCPKHFHSA-N |
| XLogP | 3.23 |
| TPSA | 133.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|