C25H42N4O5S — CID 142573328
N-(4-ethylphenyl)-2-(methylamino)propanamide;N-methyl-4-oxo-N-[3-oxo-3-(2-oxoethylamino)propyl]-3-sulfanylbutanamide;propane (PubChem CID 142573328) has the molecular formula C25H42N4O5S and a molecular weight of 510.70 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-(methylamino)propanamide;N-methyl-4-oxo-N-[3-oxo-3-(2-oxoethylamino)propyl]-3-sulfanylbutanamide;propane.
| Compound Name | N-(4-ethylphenyl)-2-(methylamino)propanamide;N-methyl-4-oxo-N-[3-oxo-3-(2-oxoethylamino)propyl]-3-sulfanylbutanamide;propane |
|---|---|
| PubChem CID | 142573328 |
| Molecular Formula | C25H42N4O5S |
| Molecular Weight | 510.70 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | N-(4-ethylphenyl)-2-(methylamino)propanamide;N-methyl-4-oxo-N-[3-oxo-3-(2-oxoethylamino)propyl]-3-sulfanylbutanamide;propane |
| SMILES | CCC.CCc1ccc(NC(=O)C(C)NC)cc1.CN(CCC(=O)NCC=O)C(=O)CC(S)C=O |
| InChI | InChI=1S/C12H18N2O.C10H16N2O4S.C3H8/c1-4-10-5-7-11(8-6-10)14-12(15)9(2)13-3;1-12(10(16)6-8(17)7-14)4-2-9(15)11-3-5-13;1-3-2/h5-9,13H,4H2,1-3H3,(H,14,15);5,7-8,17H,2-4,6H2,1H3,(H,11,15);3H2,1-2H3 |
| InChIKey | DLQSGJLKVGFSQF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.70 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|