C14H7Cl2F4NO3 — CID 142574461
methyl 3-chloro-6-[2-chloro-4-(trifluoromethoxy)phenyl]-5-fluoropyridine-2-carboxylate (PubChem CID 142574461) has the molecular formula C14H7Cl2F4NO3 and a molecular weight of 384.11 g/mol. Its IUPAC name is methyl 3-chloro-6-[2-chloro-4-(trifluoromethoxy)phenyl]-5-fluoropyridine-2-carboxylate.
| Compound Name | methyl 3-chloro-6-[2-chloro-4-(trifluoromethoxy)phenyl]-5-fluoropyridine-2-carboxylate |
|---|---|
| PubChem CID | 142574461 |
| Molecular Formula | C14H7Cl2F4NO3 |
| Molecular Weight | 384.11 g/mol |
| Exact Mass | 382.97 |
| IUPAC Name | methyl 3-chloro-6-[2-chloro-4-(trifluoromethoxy)phenyl]-5-fluoropyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(OC(F)(F)F)cc2Cl)c(F)cc1Cl |
| InChI | InChI=1S/C14H7Cl2F4NO3/c1-23-13(22)12-9(16)5-10(17)11(21-12)7-3-2-6(4-8(7)15)24-14(18,19)20/h2-5H,1H3 |
| InChIKey | HCJGVZNIYAUCEH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.11 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |