C22H29NO — CID 142574637
(3S)-N,3-dimethyl-N-[(4-phenoxyphenyl)methyl]hept-1-en-2-amine (PubChem CID 142574637) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is (3S)-N,3-dimethyl-N-[(4-phenoxyphenyl)methyl]hept-1-en-2-amine.
| Compound Name | (3S)-N,3-dimethyl-N-[(4-phenoxyphenyl)methyl]hept-1-en-2-amine |
|---|---|
| PubChem CID | 142574637 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | (3S)-N,3-dimethyl-N-[(4-phenoxyphenyl)methyl]hept-1-en-2-amine |
| SMILES | C=C([C@@H](C)CCCC)N(C)Cc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H29NO/c1-5-6-10-18(2)19(3)23(4)17-20-13-15-22(16-14-20)24-21-11-8-7-9-12-21/h7-9,11-16,18H,3,5-6,10,17H2,1-2,4H3/t18-/m0/s1 |
| InChIKey | FQUCORZUXSKQGP-SFHVURJKSA-N |
| XLogP | 6.25 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |