C23H25F2N5O3 — CID 142576627
5-(4,6-difluoro-1H-indole-2-carbonyl)-N-[1-(ethoxymethyl)cyclopropyl]-N-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide (PubChem CID 142576627) has the molecular formula C23H25F2N5O3 and a molecular weight of 457.48 g/mol. Its IUPAC name is 5-(4,6-difluoro-1H-indole-2-carbonyl)-N-[1-(ethoxymethyl)cyclopropyl]-N-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide.
| Compound Name | 5-(4,6-difluoro-1H-indole-2-carbonyl)-N-[1-(ethoxymethyl)cyclopropyl]-N-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142576627 |
| Molecular Formula | C23H25F2N5O3 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 5-(4,6-difluoro-1H-indole-2-carbonyl)-N-[1-(ethoxymethyl)cyclopropyl]-N-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide |
| SMILES | CCOCC1(N(C)C(=O)c2n[nH]c3c2CN(C(=O)c2cc4c(F)cc(F)cc4[nH]2)CC3)CC1 |
| InChI | InChI=1S/C23H25F2N5O3/c1-3-33-12-23(5-6-23)29(2)22(32)20-15-11-30(7-4-17(15)27-28-20)21(31)19-10-14-16(25)8-13(24)9-18(14)26-19/h8-10,26H,3-7,11-12H2,1-2H3,(H,27,28) |
| InChIKey | ATRHAQUAPBPQSV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |