C22H23F2N5O3 — CID 142576831
5-(5,6-difluoro-1H-indole-2-carbonyl)-N-[1-(methoxymethyl)cyclopropyl]-N-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide (PubChem CID 142576831) has the molecular formula C22H23F2N5O3 and a molecular weight of 443.45 g/mol. Its IUPAC name is 5-(5,6-difluoro-1H-indole-2-carbonyl)-N-[1-(methoxymethyl)cyclopropyl]-N-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide.
| Compound Name | 5-(5,6-difluoro-1H-indole-2-carbonyl)-N-[1-(methoxymethyl)cyclopropyl]-N-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142576831 |
| Molecular Formula | C22H23F2N5O3 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 5-(5,6-difluoro-1H-indole-2-carbonyl)-N-[1-(methoxymethyl)cyclopropyl]-N-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide |
| SMILES | COCC1(N(C)C(=O)c2n[nH]c3c2CN(C(=O)c2cc4cc(F)c(F)cc4[nH]2)CC3)CC1 |
| InChI | InChI=1S/C22H23F2N5O3/c1-28(22(4-5-22)11-32-2)21(31)19-13-10-29(6-3-16(13)26-27-19)20(30)18-8-12-7-14(23)15(24)9-17(12)25-18/h7-9,25H,3-6,10-11H2,1-2H3,(H,26,27) |
| InChIKey | DHBVTDISENRKMW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |