C19H21N5O3 — CID 142576721
5-(1H-indole-2-carbonyl)-N-(2-methoxyethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide (PubChem CID 142576721) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is 5-(1H-indole-2-carbonyl)-N-(2-methoxyethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide.
| Compound Name | 5-(1H-indole-2-carbonyl)-N-(2-methoxyethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142576721 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 5-(1H-indole-2-carbonyl)-N-(2-methoxyethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide |
| SMILES | COCCNC(=O)c1n[nH]c2c1CN(C(=O)c1cc3ccccc3[nH]1)CC2 |
| InChI | InChI=1S/C19H21N5O3/c1-27-9-7-20-18(25)17-13-11-24(8-6-15(13)22-23-17)19(26)16-10-12-4-2-3-5-14(12)21-16/h2-5,10,21H,6-9,11H2,1H3,(H,20,25)(H,22,23) |
| InChIKey | QULRYVMORVKAKK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 103.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|