C15H24N4O4 — CID 42873438
tert-butyl 3-(2-methoxyethylcarbamoyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxylate (PubChem CID 42873438) has the molecular formula C15H24N4O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is tert-butyl 3-(2-methoxyethylcarbamoyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 3-(2-methoxyethylcarbamoyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 42873438 |
| Molecular Formula | C15H24N4O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | tert-butyl 3-(2-methoxyethylcarbamoyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxylate |
| SMILES | COCCNC(=O)c1n[nH]c2c1CN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C15H24N4O4/c1-15(2,3)23-14(21)19-7-5-11-10(9-19)12(18-17-11)13(20)16-6-8-22-4/h5-9H2,1-4H3,(H,16,20)(H,17,18) |
| InChIKey | SHLAYBNFKLKSSA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|