C21H23FN6O3 — CID 156769658
5-N-(3-cyano-4-fluorophenyl)-3-N-[1-(methoxymethyl)cyclopropyl]-3-N-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxamide (PubChem CID 156769658) has the molecular formula C21H23FN6O3 and a molecular weight of 426.45 g/mol. Its IUPAC name is 5-N-(3-cyano-4-fluorophenyl)-3-N-[1-(methoxymethyl)cyclopropyl]-3-N-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxamide.
| Compound Name | 5-N-(3-cyano-4-fluorophenyl)-3-N-[1-(methoxymethyl)cyclopropyl]-3-N-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 156769658 |
| Molecular Formula | C21H23FN6O3 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 5-N-(3-cyano-4-fluorophenyl)-3-N-[1-(methoxymethyl)cyclopropyl]-3-N-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxamide |
| SMILES | COCC1(N(C)C(=O)c2n[nH]c3c2CN(C(=O)Nc2ccc(F)c(C#N)c2)CC3)CC1 |
| InChI | InChI=1S/C21H23FN6O3/c1-27(21(6-7-21)12-31-2)19(29)18-15-11-28(8-5-17(15)25-26-18)20(30)24-14-3-4-16(22)13(9-14)10-23/h3-4,9H,5-8,11-12H2,1-2H3,(H,24,30)(H,25,26) |
| InChIKey | KLDYJBFHDVXHAX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |