C20H22F3IN5O2 — CID 155731852
CID 155731852 (PubChem CID 155731852) has the molecular formula C20H22F3IN5O2 and a molecular weight of 548.33 g/mol.
| Compound Name | CID 155731852 |
|---|---|
| PubChem CID | 155731852 |
| Molecular Formula | C20H22F3IN5O2 |
| Molecular Weight | 548.33 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | — |
| SMILES | C[I]O.N#Cc1cc(NC(=O)N2CCc3nn4c(c3C2)C(F)(F)CCCC4)ccc1F |
| InChI | InChI=1S/C19H18F3N5O.CH4IO/c20-15-4-3-13(9-12(15)10-23)24-18(28)26-8-5-16-14(11-26)17-19(21,22)6-1-2-7-27(17)25-16;1-2-3/h3-4,9H,1-2,5-8,11H2,(H,24,28);3H,1H3 |
| InChIKey | HEYYWGRAWALVDX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|