C20H20F3N5O2S — CID 155352885
(12S)-N-(3-cyano-4-fluorophenyl)-14,14-difluoro-12-(hydroxymethyl)-12-sulfanyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 155352885) has the molecular formula C20H20F3N5O2S and a molecular weight of 451.47 g/mol. Its IUPAC name is (12S)-N-(3-cyano-4-fluorophenyl)-14,14-difluoro-12-(hydroxymethyl)-12-sulfanyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | (12S)-N-(3-cyano-4-fluorophenyl)-14,14-difluoro-12-(hydroxymethyl)-12-sulfanyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 155352885 |
| Molecular Formula | C20H20F3N5O2S |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | (12S)-N-(3-cyano-4-fluorophenyl)-14,14-difluoro-12-(hydroxymethyl)-12-sulfanyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | N#Cc1cc(NC(=O)N2CCc3nn4c(c3C2)C(F)(F)C[C@](S)(CO)CC4)ccc1F |
| InChI | InChI=1S/C20H20F3N5O2S/c21-15-2-1-13(7-12(15)8-24)25-18(30)27-5-3-16-14(9-27)17-20(22,23)10-19(31,11-29)4-6-28(17)26-16/h1-2,7,29,31H,3-6,9-11H2,(H,25,30)/t19-/m0/s1 |
| InChIKey | JXONJOSLSKLOQU-IBGZPJMESA-N |
| XLogP | 3.03 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|