C21H21F3N6O3 — CID 155341485
[4-[(3-cyano-4-fluorophenyl)carbamoyl]-14,14-difluoro-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-11-yl]methylcarbamic acid (PubChem CID 155341485) has the molecular formula C21H21F3N6O3 and a molecular weight of 462.43 g/mol. Its IUPAC name is [4-[(3-cyano-4-fluorophenyl)carbamoyl]-14,14-difluoro-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-11-yl]methylcarbamic acid.
| Compound Name | [4-[(3-cyano-4-fluorophenyl)carbamoyl]-14,14-difluoro-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-11-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 155341485 |
| Molecular Formula | C21H21F3N6O3 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | [4-[(3-cyano-4-fluorophenyl)carbamoyl]-14,14-difluoro-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-11-yl]methylcarbamic acid |
| SMILES | N#Cc1cc(NC(=O)N2CCc3nn4c(c3C2)C(F)(F)CCC(CNC(=O)O)C4)ccc1F |
| InChI | InChI=1S/C21H21F3N6O3/c22-16-2-1-14(7-13(16)8-25)27-19(31)29-6-4-17-15(11-29)18-21(23,24)5-3-12(9-26-20(32)33)10-30(18)28-17/h1-2,7,12,26H,3-6,9-11H2,(H,27,31)(H,32,33) |
| InChIKey | KZECKDPGGKKLRI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 123.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |