C22H22F5N5O2 — CID 164828889
(11R)-11-(2,2-difluoroethoxymethyl)-14,14-difluoro-N-(4-fluoro-3-isocyanophenyl)-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 164828889) has the molecular formula C22H22F5N5O2 and a molecular weight of 483.44 g/mol. Its IUPAC name is (11R)-11-(2,2-difluoroethoxymethyl)-14,14-difluoro-N-(4-fluoro-3-isocyanophenyl)-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | (11R)-11-(2,2-difluoroethoxymethyl)-14,14-difluoro-N-(4-fluoro-3-isocyanophenyl)-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 164828889 |
| Molecular Formula | C22H22F5N5O2 |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | (11R)-11-(2,2-difluoroethoxymethyl)-14,14-difluoro-N-(4-fluoro-3-isocyanophenyl)-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | [C-]#[N+]c1cc(NC(=O)N2CCc3nn4c(c3C2)C(F)(F)CC[C@@H](COCC(F)F)C4)ccc1F |
| InChI | InChI=1S/C22H22F5N5O2/c1-28-18-8-14(2-3-16(18)23)29-21(33)31-7-5-17-15(10-31)20-22(26,27)6-4-13(9-32(20)30-17)11-34-12-19(24)25/h2-3,8,13,19H,4-7,9-12H2,(H,29,33)/t13-/m1/s1 |
| InChIKey | OYKKEDBFDPQSJT-CYBMUJFWSA-N |
| XLogP | 4.95 |
| TPSA | 63.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|