C22H25FN6O3 — CID 153499722
(11R)-N-(4-fluoro-3-isocyanophenyl)-11-[(1R)-1-hydroxypropyl]-13-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 153499722) has the molecular formula C22H25FN6O3 and a molecular weight of 440.48 g/mol. Its IUPAC name is (11R)-N-(4-fluoro-3-isocyanophenyl)-11-[(1R)-1-hydroxypropyl]-13-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | (11R)-N-(4-fluoro-3-isocyanophenyl)-11-[(1R)-1-hydroxypropyl]-13-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 153499722 |
| Molecular Formula | C22H25FN6O3 |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | (11R)-N-(4-fluoro-3-isocyanophenyl)-11-[(1R)-1-hydroxypropyl]-13-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | [C-]#[N+]c1cc(NC(=O)N2CCc3nn4c(c3C2)C(=O)N(C)C[C@@H]([C@H](O)CC)C4)ccc1F |
| InChI | InChI=1S/C22H25FN6O3/c1-4-19(30)13-10-27(3)21(31)20-15-12-28(8-7-17(15)26-29(20)11-13)22(32)25-14-5-6-16(23)18(9-14)24-2/h5-6,9,13,19,30H,4,7-8,10-12H2,1,3H3,(H,25,32)/t13-,19-/m1/s1 |
| InChIKey | UHULIDBJJVUGOR-BFUOFWGJSA-N |
| XLogP | 2.64 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|