C20H20F3N5O2 — CID 164828895
(11R)-14,14-difluoro-N-(4-fluoro-3-isocyanophenyl)-11-hydroxy-11-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 164828895) has the molecular formula C20H20F3N5O2 and a molecular weight of 419.41 g/mol. Its IUPAC name is (11R)-14,14-difluoro-N-(4-fluoro-3-isocyanophenyl)-11-hydroxy-11-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | (11R)-14,14-difluoro-N-(4-fluoro-3-isocyanophenyl)-11-hydroxy-11-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 164828895 |
| Molecular Formula | C20H20F3N5O2 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | (11R)-14,14-difluoro-N-(4-fluoro-3-isocyanophenyl)-11-hydroxy-11-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | [C-]#[N+]c1cc(NC(=O)N2CCc3nn4c(c3C2)C(F)(F)CC[C@@](C)(O)C4)ccc1F |
| InChI | InChI=1S/C20H20F3N5O2/c1-19(30)6-7-20(22,23)17-13-10-27(8-5-15(13)26-28(17)11-19)18(29)25-12-3-4-14(21)16(9-12)24-2/h3-4,9,30H,5-8,10-11H2,1H3,(H,25,29)/t19-/m1/s1 |
| InChIKey | CXIRJPVLFOBZTM-LJQANCHMSA-N |
| XLogP | 3.80 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|