C23H26F3N5O2 — CID 164828883
(5R,11R)-14,14-difluoro-N-(4-fluoro-3-isocyanophenyl)-11-(2-hydroxypropan-2-yl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 164828883) has the molecular formula C23H26F3N5O2 and a molecular weight of 461.49 g/mol. Its IUPAC name is (5R,11R)-14,14-difluoro-N-(4-fluoro-3-isocyanophenyl)-11-(2-hydroxypropan-2-yl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | (5R,11R)-14,14-difluoro-N-(4-fluoro-3-isocyanophenyl)-11-(2-hydroxypropan-2-yl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 164828883 |
| Molecular Formula | C23H26F3N5O2 |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | (5R,11R)-14,14-difluoro-N-(4-fluoro-3-isocyanophenyl)-11-(2-hydroxypropan-2-yl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | [C-]#[N+]c1cc(NC(=O)N2Cc3c(nn4c3C(F)(F)CC[C@@H](C(C)(C)O)C4)C[C@H]2C)ccc1F |
| InChI | InChI=1S/C23H26F3N5O2/c1-13-9-18-16(12-30(13)21(32)28-15-5-6-17(24)19(10-15)27-4)20-23(25,26)8-7-14(22(2,3)33)11-31(20)29-18/h5-6,10,13-14,33H,7-9,11-12H2,1-3H3,(H,28,32)/t13-,14-/m1/s1 |
| InChIKey | KDUJPDNHIHNIDT-ZIAGYGMSSA-N |
| XLogP | 4.82 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|