C20H21FN6O3 — CID 153499720
(5S,11R)-N-(4-fluoro-3-isocyanophenyl)-5-(hydroxymethyl)-4,11-dimethyl-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-12-carboxamide (PubChem CID 153499720) has the molecular formula C20H21FN6O3 and a molecular weight of 412.43 g/mol. Its IUPAC name is (5S,11R)-N-(4-fluoro-3-isocyanophenyl)-5-(hydroxymethyl)-4,11-dimethyl-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-12-carboxamide.
| Compound Name | (5S,11R)-N-(4-fluoro-3-isocyanophenyl)-5-(hydroxymethyl)-4,11-dimethyl-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-12-carboxamide |
|---|---|
| PubChem CID | 153499720 |
| Molecular Formula | C20H21FN6O3 |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (5S,11R)-N-(4-fluoro-3-isocyanophenyl)-5-(hydroxymethyl)-4,11-dimethyl-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-12-carboxamide |
| SMILES | [C-]#[N+]c1cc(NC(=O)N2Cc3c(nn4c3C(=O)N(C)[C@H](CO)C4)C[C@H]2C)ccc1F |
| InChI | InChI=1S/C20H21FN6O3/c1-11-6-16-14(18-19(29)25(3)13(10-28)8-27(18)24-16)9-26(11)20(30)23-12-4-5-15(21)17(7-12)22-2/h4-5,7,11,13,28H,6,8-10H2,1,3H3,(H,23,30)/t11-,13+/m1/s1 |
| InChIKey | QMLRDFZVICKXCV-YPMHNXCESA-N |
| XLogP | 2.00 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|