C23H28FN5O3 — CID 161070757
(5R,11S)-N-(4-fluoro-3-methylphenyl)-11-[(1R)-1-hydroxyprop-2-enyl]-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 161070757) has the molecular formula C23H28FN5O3 and a molecular weight of 441.51 g/mol. Its IUPAC name is (5R,11S)-N-(4-fluoro-3-methylphenyl)-11-[(1R)-1-hydroxyprop-2-enyl]-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | (5R,11S)-N-(4-fluoro-3-methylphenyl)-11-[(1R)-1-hydroxyprop-2-enyl]-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 161070757 |
| Molecular Formula | C23H28FN5O3 |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | (5R,11S)-N-(4-fluoro-3-methylphenyl)-11-[(1R)-1-hydroxyprop-2-enyl]-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | C=C[C@@H](O)[C@H]1CN(C)C(=O)c2c3c(nn2C1)C[C@@H](C)N(C(=O)Nc1ccc(F)c(C)c1)C3 |
| InChI | InChI=1S/C23H28FN5O3/c1-5-20(30)15-10-27(4)22(31)21-17-12-28(14(3)9-19(17)26-29(21)11-15)23(32)25-16-6-7-18(24)13(2)8-16/h5-8,14-15,20,30H,1,9-12H2,2-4H3,(H,25,32)/t14-,15+,20-/m1/s1 |
| InChIKey | GCHZWIPURFGSDQ-QEEYODRMSA-N |
| XLogP | 2.56 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|