C21H24F3N5O2 — CID 146625464
(5R)-13-(2,2-difluoroethyl)-N-(4-fluoro-3-methylphenyl)-5-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 146625464) has the molecular formula C21H24F3N5O2 and a molecular weight of 435.45 g/mol. Its IUPAC name is (5R)-13-(2,2-difluoroethyl)-N-(4-fluoro-3-methylphenyl)-5-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | (5R)-13-(2,2-difluoroethyl)-N-(4-fluoro-3-methylphenyl)-5-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 146625464 |
| Molecular Formula | C21H24F3N5O2 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | (5R)-13-(2,2-difluoroethyl)-N-(4-fluoro-3-methylphenyl)-5-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | Cc1cc(NC(=O)N2Cc3c(nn4c3C(=O)N(CC(F)F)CCC4)C[C@H]2C)ccc1F |
| InChI | InChI=1S/C21H24F3N5O2/c1-12-8-14(4-5-16(12)22)25-21(31)28-10-15-17(9-13(28)2)26-29-7-3-6-27(11-18(23)24)20(30)19(15)29/h4-5,8,13,18H,3,6-7,9-11H2,1-2H3,(H,25,31)/t13-/m1/s1 |
| InChIKey | CSZQHOJCPHDZCS-CYBMUJFWSA-N |
| XLogP | 3.42 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |