C22H29F3N4O2 — CID 167650567
(5R,11S)-14,14-difluoro-N-(4-fluoro-3-methylphenyl)-11-(hydroxymethyl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide;methane (PubChem CID 167650567) has the molecular formula C22H29F3N4O2 and a molecular weight of 438.49 g/mol. Its IUPAC name is (5R,11S)-14,14-difluoro-N-(4-fluoro-3-methylphenyl)-11-(hydroxymethyl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide;methane.
| Compound Name | (5R,11S)-14,14-difluoro-N-(4-fluoro-3-methylphenyl)-11-(hydroxymethyl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide;methane |
|---|---|
| PubChem CID | 167650567 |
| Molecular Formula | C22H29F3N4O2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | (5R,11S)-14,14-difluoro-N-(4-fluoro-3-methylphenyl)-11-(hydroxymethyl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide;methane |
| SMILES | C.Cc1cc(NC(=O)N2Cc3c(nn4c3C(F)(F)CC[C@H](CO)C4)C[C@H]2C)ccc1F |
| InChI | InChI=1S/C21H25F3N4O2.CH4/c1-12-7-15(3-4-17(12)22)25-20(30)27-10-16-18(8-13(27)2)26-28-9-14(11-29)5-6-21(23,24)19(16)28;/h3-4,7,13-14,29H,5-6,8-11H2,1-2H3,(H,25,30);1H4/t13-,14+;/m1./s1 |
| InChIKey | QNBDUQGJAOCXPL-DFQHDRSWSA-N |
| XLogP | 4.44 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |