C20H21Cl2F2N3O2 — CID 165381886
(3,4-dichlorophenyl)-[(5R)-14,14-difluoro-11-(hydroxymethyl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-4-yl]methanone (PubChem CID 165381886) has the molecular formula C20H21Cl2F2N3O2 and a molecular weight of 444.31 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[(5R)-14,14-difluoro-11-(hydroxymethyl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-4-yl]methanone.
| Compound Name | (3,4-dichlorophenyl)-[(5R)-14,14-difluoro-11-(hydroxymethyl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-4-yl]methanone |
|---|---|
| PubChem CID | 165381886 |
| Molecular Formula | C20H21Cl2F2N3O2 |
| Molecular Weight | 444.31 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | (3,4-dichlorophenyl)-[(5R)-14,14-difluoro-11-(hydroxymethyl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-4-yl]methanone |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)c1ccc(Cl)c(Cl)c1)C(F)(F)CCC(CO)C3 |
| InChI | InChI=1S/C20H21Cl2F2N3O2/c1-11-6-17-14(9-26(11)19(29)13-2-3-15(21)16(22)7-13)18-20(23,24)5-4-12(10-28)8-27(18)25-17/h2-3,7,11-12,28H,4-6,8-10H2,1H3/t11-,12?/m1/s1 |
| InChIKey | TXRTWOJCVNXFNS-JHJMLUEUSA-N |
| XLogP | 4.27 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |