C21H19Cl2F2N3O2 — CID 155343762
(3,4-dichlorophenyl)-[(5R,11R)-11-ethynyl-14,14-difluoro-11-hydroxy-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-4-yl]methanone (PubChem CID 155343762) has the molecular formula C21H19Cl2F2N3O2 and a molecular weight of 454.30 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[(5R,11R)-11-ethynyl-14,14-difluoro-11-hydroxy-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-4-yl]methanone.
| Compound Name | (3,4-dichlorophenyl)-[(5R,11R)-11-ethynyl-14,14-difluoro-11-hydroxy-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-4-yl]methanone |
|---|---|
| PubChem CID | 155343762 |
| Molecular Formula | C21H19Cl2F2N3O2 |
| Molecular Weight | 454.30 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | (3,4-dichlorophenyl)-[(5R,11R)-11-ethynyl-14,14-difluoro-11-hydroxy-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-4-yl]methanone |
| SMILES | C#C[C@]1(O)CCC(F)(F)c2c3c(nn2C1)C[C@@H](C)N(C(=O)c1ccc(Cl)c(Cl)c1)C3 |
| InChI | InChI=1S/C21H19Cl2F2N3O2/c1-3-20(30)6-7-21(24,25)18-14-10-27(12(2)8-17(14)26-28(18)11-20)19(29)13-4-5-15(22)16(23)9-13/h1,4-5,9,12,30H,6-8,10-11H2,2H3/t12-,20+/m1/s1 |
| InChIKey | DSMRLSQQYKIYLY-ODXCJYRJSA-N |
| XLogP | 4.03 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|