C27H25Cl2N5O2 — CID 167220883
4-[(1S)-1-[(6R,11R)-12-(3,4-dichlorobenzoyl)-6,11-dimethyl-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-4-yl]ethyl]benzonitrile (PubChem CID 167220883) has the molecular formula C27H25Cl2N5O2 and a molecular weight of 522.44 g/mol. Its IUPAC name is 4-[(1S)-1-[(6R,11R)-12-(3,4-dichlorobenzoyl)-6,11-dimethyl-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-4-yl]ethyl]benzonitrile.
| Compound Name | 4-[(1S)-1-[(6R,11R)-12-(3,4-dichlorobenzoyl)-6,11-dimethyl-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-4-yl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 167220883 |
| Molecular Formula | C27H25Cl2N5O2 |
| Molecular Weight | 522.44 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 4-[(1S)-1-[(6R,11R)-12-(3,4-dichlorobenzoyl)-6,11-dimethyl-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-4-yl]ethyl]benzonitrile |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)c1ccc(Cl)c(Cl)c1)C(=O)N([C@@H](C)c1ccc(C#N)cc1)C[C@H]3C |
| InChI | InChI=1S/C27H25Cl2N5O2/c1-15-10-24-21(14-32(15)26(35)20-8-9-22(28)23(29)11-20)25-27(36)33(13-16(2)34(25)31-24)17(3)19-6-4-18(12-30)5-7-19/h4-9,11,15-17H,10,13-14H2,1-3H3/t15-,16-,17+/m1/s1 |
| InChIKey | NIIHPXWBOYLCEE-ZACQAIPSSA-N |
| XLogP | 5.43 |
| TPSA | 82.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |