C25H26Cl2N6O3 — CID 167220976
(6R,11R)-12-(3,4-dichlorobenzoyl)-6,11-dimethyl-4-[(1S)-1-(1-methyl-6-oxopyridazin-3-yl)ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one (PubChem CID 167220976) has the molecular formula C25H26Cl2N6O3 and a molecular weight of 529.43 g/mol. Its IUPAC name is (6R,11R)-12-(3,4-dichlorobenzoyl)-6,11-dimethyl-4-[(1S)-1-(1-methyl-6-oxopyridazin-3-yl)ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one.
| Compound Name | (6R,11R)-12-(3,4-dichlorobenzoyl)-6,11-dimethyl-4-[(1S)-1-(1-methyl-6-oxopyridazin-3-yl)ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
|---|---|
| PubChem CID | 167220976 |
| Molecular Formula | C25H26Cl2N6O3 |
| Molecular Weight | 529.43 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | (6R,11R)-12-(3,4-dichlorobenzoyl)-6,11-dimethyl-4-[(1S)-1-(1-methyl-6-oxopyridazin-3-yl)ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)c1ccc(Cl)c(Cl)c1)C(=O)N([C@@H](C)c1ccc(=O)n(C)n1)C[C@H]3C |
| InChI | InChI=1S/C25H26Cl2N6O3/c1-13-9-21-17(12-31(13)24(35)16-5-6-18(26)19(27)10-16)23-25(36)32(11-14(2)33(23)29-21)15(3)20-7-8-22(34)30(4)28-20/h5-8,10,13-15H,9,11-12H2,1-4H3/t13-,14-,15+/m1/s1 |
| InChIKey | KUXRDOFOUKPMFY-KFWWJZLASA-N |
| XLogP | 3.65 |
| TPSA | 93.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |