C26H25Cl3N6O3 — CID 167248616
(6S,11R)-4-[(1S)-1-(6-chloro-2-pyridinyl)ethyl]-12-(3,4-dichlorobenzoyl)-N,11-dimethyl-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-6-carboxamide (PubChem CID 167248616) has the molecular formula C26H25Cl3N6O3 and a molecular weight of 575.88 g/mol. Its IUPAC name is (6S,11R)-4-[(1S)-1-(6-chloro-2-pyridinyl)ethyl]-12-(3,4-dichlorobenzoyl)-N,11-dimethyl-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-6-carboxamide.
| Compound Name | (6S,11R)-4-[(1S)-1-(6-chloro-2-pyridinyl)ethyl]-12-(3,4-dichlorobenzoyl)-N,11-dimethyl-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-6-carboxamide |
|---|---|
| PubChem CID | 167248616 |
| Molecular Formula | C26H25Cl3N6O3 |
| Molecular Weight | 575.88 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | (6S,11R)-4-[(1S)-1-(6-chloro-2-pyridinyl)ethyl]-12-(3,4-dichlorobenzoyl)-N,11-dimethyl-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-6-carboxamide |
| SMILES | CNC(=O)[C@@H]1CN([C@@H](C)c2cccc(Cl)n2)C(=O)c2c3c(nn21)C[C@@H](C)N(C(=O)c1ccc(Cl)c(Cl)c1)C3 |
| InChI | InChI=1S/C26H25Cl3N6O3/c1-13-9-20-16(11-33(13)25(37)15-7-8-17(27)18(28)10-15)23-26(38)34(12-21(24(36)30-3)35(23)32-20)14(2)19-5-4-6-22(29)31-19/h4-8,10,13-14,21H,9,11-12H2,1-3H3,(H,30,36)/t13-,14+,21+/m1/s1 |
| InChIKey | MDCLFYDEBSZZHL-YPENRWOSSA-N |
| XLogP | 4.33 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.88 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|