C29H29Cl2N9O3 — CID 167248646
(6S,11R)-12-(3,4-dichlorobenzoyl)-N,11-dimethyl-4-[1-[4-(1-methyltetrazol-5-yl)phenyl]ethyl]-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-6-carboxamide (PubChem CID 167248646) has the molecular formula C29H29Cl2N9O3 and a molecular weight of 622.52 g/mol. Its IUPAC name is (6S,11R)-12-(3,4-dichlorobenzoyl)-N,11-dimethyl-4-[1-[4-(1-methyltetrazol-5-yl)phenyl]ethyl]-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-6-carboxamide.
| Compound Name | (6S,11R)-12-(3,4-dichlorobenzoyl)-N,11-dimethyl-4-[1-[4-(1-methyltetrazol-5-yl)phenyl]ethyl]-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-6-carboxamide |
|---|---|
| PubChem CID | 167248646 |
| Molecular Formula | C29H29Cl2N9O3 |
| Molecular Weight | 622.52 g/mol |
| Exact Mass | 621.18 |
| IUPAC Name | (6S,11R)-12-(3,4-dichlorobenzoyl)-N,11-dimethyl-4-[1-[4-(1-methyltetrazol-5-yl)phenyl]ethyl]-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-6-carboxamide |
| SMILES | CNC(=O)[C@@H]1CN(C(C)c2ccc(-c3nnnn3C)cc2)C(=O)c2c3c(nn21)C[C@@H](C)N(C(=O)c1ccc(Cl)c(Cl)c1)C3 |
| InChI | InChI=1S/C29H29Cl2N9O3/c1-15-11-23-20(13-38(15)28(42)19-9-10-21(30)22(31)12-19)25-29(43)39(14-24(27(41)32-3)40(25)34-23)16(2)17-5-7-18(8-6-17)26-33-35-36-37(26)4/h5-10,12,15-16,24H,11,13-14H2,1-4H3,(H,32,41)/t15-,16?,24+/m1/s1 |
| InChIKey | LGFUAZWXDXPXJJ-UFGRBNTRSA-N |
| XLogP | 3.47 |
| TPSA | 131.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |