C25H24Cl3N5O3 — CID 167248615
(6S,11R)-4-[1-(6-chloro-2-pyridinyl)ethyl]-12-(3,4-dichlorobenzoyl)-6-(hydroxymethyl)-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one (PubChem CID 167248615) has the molecular formula C25H24Cl3N5O3 and a molecular weight of 548.86 g/mol. Its IUPAC name is (6S,11R)-4-[1-(6-chloro-2-pyridinyl)ethyl]-12-(3,4-dichlorobenzoyl)-6-(hydroxymethyl)-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one.
| Compound Name | (6S,11R)-4-[1-(6-chloro-2-pyridinyl)ethyl]-12-(3,4-dichlorobenzoyl)-6-(hydroxymethyl)-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
|---|---|
| PubChem CID | 167248615 |
| Molecular Formula | C25H24Cl3N5O3 |
| Molecular Weight | 548.86 g/mol |
| Exact Mass | 547.09 |
| IUPAC Name | (6S,11R)-4-[1-(6-chloro-2-pyridinyl)ethyl]-12-(3,4-dichlorobenzoyl)-6-(hydroxymethyl)-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
| SMILES | CC(c1cccc(Cl)n1)N1C[C@@H](CO)n2nc3c(c2C1=O)CN(C(=O)c1ccc(Cl)c(Cl)c1)[C@H](C)C3 |
| InChI | InChI=1S/C25H24Cl3N5O3/c1-13-8-21-17(11-31(13)24(35)15-6-7-18(26)19(27)9-15)23-25(36)32(10-16(12-34)33(23)30-21)14(2)20-4-3-5-22(28)29-20/h3-7,9,13-14,16,34H,8,10-12H2,1-2H3/t13-,14?,16+/m1/s1 |
| InChIKey | ORJDBOJRMNXGLY-XIFZVWCKSA-N |
| XLogP | 4.58 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.86 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|