C25H23Cl2F3N6O2 — CID 167221131
(6R,11R)-12-(3,4-dichlorobenzoyl)-6,11-dimethyl-4-[(1S)-1-[5-(trifluoromethyl)pyrazin-2-yl]ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one (PubChem CID 167221131) has the molecular formula C25H23Cl2F3N6O2 and a molecular weight of 567.40 g/mol. Its IUPAC name is (6R,11R)-12-(3,4-dichlorobenzoyl)-6,11-dimethyl-4-[(1S)-1-[5-(trifluoromethyl)pyrazin-2-yl]ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one.
| Compound Name | (6R,11R)-12-(3,4-dichlorobenzoyl)-6,11-dimethyl-4-[(1S)-1-[5-(trifluoromethyl)pyrazin-2-yl]ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
|---|---|
| PubChem CID | 167221131 |
| Molecular Formula | C25H23Cl2F3N6O2 |
| Molecular Weight | 567.40 g/mol |
| Exact Mass | 566.12 |
| IUPAC Name | (6R,11R)-12-(3,4-dichlorobenzoyl)-6,11-dimethyl-4-[(1S)-1-[5-(trifluoromethyl)pyrazin-2-yl]ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)c1ccc(Cl)c(Cl)c1)C(=O)N([C@@H](C)c1cnc(C(F)(F)F)cn1)C[C@H]3C |
| InChI | InChI=1S/C25H23Cl2F3N6O2/c1-12-6-19-16(11-34(12)23(37)15-4-5-17(26)18(27)7-15)22-24(38)35(10-13(2)36(22)33-19)14(3)20-8-32-21(9-31-20)25(28,29)30/h4-5,7-9,12-14H,6,10-11H2,1-3H3/t12-,13-,14+/m1/s1 |
| InChIKey | KYXNAAIWLWFYTC-MCIONIFRSA-N |
| XLogP | 5.36 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.40 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |