C25H24ClF3N6O3 — CID 167220823
(6R,11R)-12-[4-chloro-3-(trifluoromethyl)benzoyl]-6,11-dimethyl-4-[1-(6-oxo-1H-pyridazin-4-yl)ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one (PubChem CID 167220823) has the molecular formula C25H24ClF3N6O3 and a molecular weight of 548.95 g/mol. Its IUPAC name is (6R,11R)-12-[4-chloro-3-(trifluoromethyl)benzoyl]-6,11-dimethyl-4-[1-(6-oxo-1H-pyridazin-4-yl)ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one.
| Compound Name | (6R,11R)-12-[4-chloro-3-(trifluoromethyl)benzoyl]-6,11-dimethyl-4-[1-(6-oxo-1H-pyridazin-4-yl)ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
|---|---|
| PubChem CID | 167220823 |
| Molecular Formula | C25H24ClF3N6O3 |
| Molecular Weight | 548.95 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | (6R,11R)-12-[4-chloro-3-(trifluoromethyl)benzoyl]-6,11-dimethyl-4-[1-(6-oxo-1H-pyridazin-4-yl)ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
| SMILES | CC(c1cn[nH]c(=O)c1)N1C[C@@H](C)n2nc3c(c2C1=O)CN(C(=O)c1ccc(Cl)c(C(F)(F)F)c1)[C@H](C)C3 |
| InChI | InChI=1S/C25H24ClF3N6O3/c1-12-6-20-17(11-33(12)23(37)15-4-5-19(26)18(7-15)25(27,28)29)22-24(38)34(10-13(2)35(22)32-20)14(3)16-8-21(36)31-30-9-16/h4-5,7-9,12-14H,6,10-11H2,1-3H3,(H,31,36)/t12-,13-,14?/m1/s1 |
| InChIKey | YAQCYMCUHKYPLP-ZFXTZCCVSA-N |
| XLogP | 4.00 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.95 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |