C19H25F2N3O3 — CID 155341541
tert-butyl (5R)-11-ethynyl-14,14-difluoro-11-hydroxy-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate (PubChem CID 155341541) has the molecular formula C19H25F2N3O3 and a molecular weight of 381.42 g/mol. Its IUPAC name is tert-butyl (5R)-11-ethynyl-14,14-difluoro-11-hydroxy-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate.
| Compound Name | tert-butyl (5R)-11-ethynyl-14,14-difluoro-11-hydroxy-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate |
|---|---|
| PubChem CID | 155341541 |
| Molecular Formula | C19H25F2N3O3 |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | tert-butyl (5R)-11-ethynyl-14,14-difluoro-11-hydroxy-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate |
| SMILES | C#CC1(O)CCC(F)(F)c2c3c(nn2C1)C[C@@H](C)N(C(=O)OC(C)(C)C)C3 |
| InChI | InChI=1S/C19H25F2N3O3/c1-6-18(26)7-8-19(20,21)15-13-10-23(16(25)27-17(3,4)5)12(2)9-14(13)22-24(15)11-18/h1,12,26H,7-11H2,2-5H3/t12-,18?/m1/s1 |
| InChIKey | FOXOLZALXIZDME-GKOGFXNCSA-N |
| XLogP | 2.81 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|