C17H24F3N3O3 — CID 155341625
tert-butyl (11S)-11,14,14-trifluoro-11-(hydroxymethyl)-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate (PubChem CID 155341625) has the molecular formula C17H24F3N3O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is tert-butyl (11S)-11,14,14-trifluoro-11-(hydroxymethyl)-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate.
| Compound Name | tert-butyl (11S)-11,14,14-trifluoro-11-(hydroxymethyl)-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate |
|---|---|
| PubChem CID | 155341625 |
| Molecular Formula | C17H24F3N3O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | tert-butyl (11S)-11,14,14-trifluoro-11-(hydroxymethyl)-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2nn3c(c2C1)C(F)(F)CC[C@@](F)(CO)C3 |
| InChI | InChI=1S/C17H24F3N3O3/c1-15(2,3)26-14(25)22-7-4-12-11(8-22)13-17(19,20)6-5-16(18,10-24)9-23(13)21-12/h24H,4-10H2,1-3H3/t16-/m0/s1 |
| InChIKey | XIGYBEZBIXLRBK-INIZCTEOSA-N |
| XLogP | 2.76 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |