C18H26F3N3O3 — CID 155341383
tert-butyl (5R)-11,14,14-trifluoro-11-(hydroxymethyl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate (PubChem CID 155341383) has the molecular formula C18H26F3N3O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is tert-butyl (5R)-11,14,14-trifluoro-11-(hydroxymethyl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate.
| Compound Name | tert-butyl (5R)-11,14,14-trifluoro-11-(hydroxymethyl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate |
|---|---|
| PubChem CID | 155341383 |
| Molecular Formula | C18H26F3N3O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | tert-butyl (5R)-11,14,14-trifluoro-11-(hydroxymethyl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)OC(C)(C)C)C(F)(F)CCC(F)(CO)C3 |
| InChI | InChI=1S/C18H26F3N3O3/c1-11-7-13-12(8-23(11)15(26)27-16(2,3)4)14-18(20,21)6-5-17(19,10-25)9-24(14)22-13/h11,25H,5-10H2,1-4H3/t11-,17?/m1/s1 |
| InChIKey | JDVHRRKURMPVAF-VCQTYVLVSA-N |
| XLogP | 3.15 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |