C18H27F2N3O3 — CID 155359741
tert-butyl (5R,12R)-14,14-difluoro-12-(hydroxymethyl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate (PubChem CID 155359741) has the molecular formula C18H27F2N3O3 and a molecular weight of 371.43 g/mol. Its IUPAC name is tert-butyl (5R,12R)-14,14-difluoro-12-(hydroxymethyl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate.
| Compound Name | tert-butyl (5R,12R)-14,14-difluoro-12-(hydroxymethyl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate |
|---|---|
| PubChem CID | 155359741 |
| Molecular Formula | C18H27F2N3O3 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | tert-butyl (5R,12R)-14,14-difluoro-12-(hydroxymethyl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)OC(C)(C)C)C(F)(F)C[C@H](CO)CC3 |
| InChI | InChI=1S/C18H27F2N3O3/c1-11-7-14-13(9-22(11)16(25)26-17(2,3)4)15-18(19,20)8-12(10-24)5-6-23(15)21-14/h11-12,24H,5-10H2,1-4H3/t11-,12-/m1/s1 |
| InChIKey | XCLAKEBVGTVKEZ-VXGBXAGGSA-N |
| XLogP | 3.06 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |