C19H28F2N4O4 — CID 155352782
tert-butyl 14,14-difluoro-11-[(methoxycarbonylamino)methyl]-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate (PubChem CID 155352782) has the molecular formula C19H28F2N4O4 and a molecular weight of 414.45 g/mol. Its IUPAC name is tert-butyl 14,14-difluoro-11-[(methoxycarbonylamino)methyl]-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate.
| Compound Name | tert-butyl 14,14-difluoro-11-[(methoxycarbonylamino)methyl]-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate |
|---|---|
| PubChem CID | 155352782 |
| Molecular Formula | C19H28F2N4O4 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | tert-butyl 14,14-difluoro-11-[(methoxycarbonylamino)methyl]-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate |
| SMILES | COC(=O)NCC1CCC(F)(F)c2c3c(nn2C1)CCN(C(=O)OC(C)(C)C)C3 |
| InChI | InChI=1S/C19H28F2N4O4/c1-18(2,3)29-17(27)24-8-6-14-13(11-24)15-19(20,21)7-5-12(10-25(15)23-14)9-22-16(26)28-4/h12H,5-11H2,1-4H3,(H,22,26) |
| InChIKey | SYEQUDWCIKYYAL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |