C17H23F2N3O3 — CID 155727969
tert-butyl 14,14-difluorospiro[4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-11,2'-oxirane]-4-carboxylate (PubChem CID 155727969) has the molecular formula C17H23F2N3O3 and a molecular weight of 355.39 g/mol. Its IUPAC name is tert-butyl 14,14-difluorospiro[4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-11,2'-oxirane]-4-carboxylate.
| Compound Name | tert-butyl 14,14-difluorospiro[4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-11,2'-oxirane]-4-carboxylate |
|---|---|
| PubChem CID | 155727969 |
| Molecular Formula | C17H23F2N3O3 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | tert-butyl 14,14-difluorospiro[4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-11,2'-oxirane]-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2nn3c(c2C1)C(F)(F)CCC1(CO1)C3 |
| InChI | InChI=1S/C17H23F2N3O3/c1-15(2,3)25-14(23)21-7-4-12-11(8-21)13-17(18,19)6-5-16(10-24-16)9-22(13)20-12/h4-10H2,1-3H3 |
| InChIKey | QOOCAYFDUVTQBW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 59.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|