C20H28F3N3O4 — CID 155343900
4-O-tert-butyl 11-O-ethyl (5R)-11,14,14-trifluoro-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4,11-dicarboxylate (PubChem CID 155343900) has the molecular formula C20H28F3N3O4 and a molecular weight of 431.46 g/mol. Its IUPAC name is 4-O-tert-butyl 11-O-ethyl (5R)-11,14,14-trifluoro-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4,11-dicarboxylate.
| Compound Name | 4-O-tert-butyl 11-O-ethyl (5R)-11,14,14-trifluoro-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4,11-dicarboxylate |
|---|---|
| PubChem CID | 155343900 |
| Molecular Formula | C20H28F3N3O4 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 4-O-tert-butyl 11-O-ethyl (5R)-11,14,14-trifluoro-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4,11-dicarboxylate |
| SMILES | CCOC(=O)C1(F)CCC(F)(F)c2c3c(nn2C1)C[C@@H](C)N(C(=O)OC(C)(C)C)C3 |
| InChI | InChI=1S/C20H28F3N3O4/c1-6-29-16(27)19(21)7-8-20(22,23)15-13-10-25(17(28)30-18(3,4)5)12(2)9-14(13)24-26(15)11-19/h12H,6-11H2,1-5H3/t12-,19?/m1/s1 |
| InChIKey | FHKVFDFXEQKIAX-ISGGMURCSA-N |
| XLogP | 3.72 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |