C19H20BrF4N5O2 — CID 155341319
(5R,11R)-N-(2-bromo-3-fluoro-4-pyridinyl)-11,14,14-trifluoro-11-(hydroxymethyl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 155341319) has the molecular formula C19H20BrF4N5O2 and a molecular weight of 506.30 g/mol. Its IUPAC name is (5R,11R)-N-(2-bromo-3-fluoro-4-pyridinyl)-11,14,14-trifluoro-11-(hydroxymethyl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | (5R,11R)-N-(2-bromo-3-fluoro-4-pyridinyl)-11,14,14-trifluoro-11-(hydroxymethyl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 155341319 |
| Molecular Formula | C19H20BrF4N5O2 |
| Molecular Weight | 506.30 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | (5R,11R)-N-(2-bromo-3-fluoro-4-pyridinyl)-11,14,14-trifluoro-11-(hydroxymethyl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)Nc1ccnc(Br)c1F)C(F)(F)CC[C@](F)(CO)C3 |
| InChI | InChI=1S/C19H20BrF4N5O2/c1-10-6-13-11(7-28(10)17(31)26-12-2-5-25-16(20)14(12)21)15-19(23,24)4-3-18(22,9-30)8-29(15)27-13/h2,5,10,30H,3-4,6-9H2,1H3,(H,25,26,31)/t10-,18-/m1/s1 |
| InChIKey | SZJDWCWUKSTNAJ-MLCYQJTMSA-N |
| XLogP | 3.74 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|