C18H21BrF3N5O2 — CID 155360748
(5R,11S)-4-[[(2-bromo-3-fluoro-4-pyridinyl)amino]-hydroxymethyl]-14,14-difluoro-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-11-ol (PubChem CID 155360748) has the molecular formula C18H21BrF3N5O2 and a molecular weight of 476.30 g/mol. Its IUPAC name is (5R,11S)-4-[[(2-bromo-3-fluoro-4-pyridinyl)amino]-hydroxymethyl]-14,14-difluoro-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-11-ol.
| Compound Name | (5R,11S)-4-[[(2-bromo-3-fluoro-4-pyridinyl)amino]-hydroxymethyl]-14,14-difluoro-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-11-ol |
|---|---|
| PubChem CID | 155360748 |
| Molecular Formula | C18H21BrF3N5O2 |
| Molecular Weight | 476.30 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | (5R,11S)-4-[[(2-bromo-3-fluoro-4-pyridinyl)amino]-hydroxymethyl]-14,14-difluoro-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-11-ol |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(O)Nc1ccnc(Br)c1F)C(F)(F)CC[C@H](O)C3 |
| InChI | InChI=1S/C18H21BrF3N5O2/c1-9-6-13-11(15-18(21,22)4-2-10(28)7-27(15)25-13)8-26(9)17(29)24-12-3-5-23-16(19)14(12)20/h3,5,9-10,17,28-29H,2,4,6-8H2,1H3,(H,23,24)/t9-,10+,17?/m1/s1 |
| InChIKey | IHEUIJVSXYYPTQ-ALJWHKCZSA-N |
| XLogP | 2.56 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|